IR-786 perchlorate - Alfa Chemistry | |
24 Jul 2024
IR-786 perchlorate serves as optoelectronic materials for Photonic and Optical Devices. Synonyms
2-[2-[2-Chloro-3-[2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimet;2-[2-[2-Chloro-3-[2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-3H-indoliu
What is the molecular formula of IR-786 perchlorate?
The molecular formula of IR-786 perchlorate is C32H36Cl2N2O4. What is the molecular weight of IR-786 perchlorate?
The molecular weight of IR-786 perchlorate is 583.5 g/mol. What are some synonyms for IR-786 perchlorate?
Some synonyms for IR-786 perchlorate include AKOS000813928 and CS-0435250. What is the IUPAC name of IR-786 perchlorate?
The IUPAC name of IR-786 perchlorate is (2Z)-2-[(2E)-2-[2-chloro-3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3-trimethylindole;perchlorate. What is the Canonical SMILES representation of IR-786 perchlorate?
The Canonical SMILES representation of IR-786 perchlorate is CC1(C2=CC=CC=C2[N+](=C1C=CC3=C(C(=CC=C4C(C5=CC=CC=C5N4C)(C)C)CCC3)Cl)C)C.[O-]Cl(=O)(=O)=O. How many hydrogen bond acceptor counts does IR-786 perchlorate have?
IR-786 perchlorate has 5 hydrogen bond acceptor counts. What is the topological polar surface area of IR-786 perchlorate?
The topological polar surface area of IR-786 perchlorate is 80.5 Ų. How many defined bond stereocenter counts does IR-786 perchlorate have?
IR-786 perchlorate has 3 defined bond stereocenter counts. Is IR-786 perchlorate a canonicalized compound?
Yes, IR-786 perchlorate is a canonicalized compound according to PubChem. |
Alfa Chemistry |
Colin Dr |
Holbrook |
New York |
11741 |
United States |
Tel: 1-516-734-6573 |
Fax: 1-516-927-0118 |
Email Us |
Web Site |
© 2025 SPIE Europe |
|